CAS 1289388-68-6

Pyrrolidine, 2-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2,6-dichlorophenyl group indicates that the compound has significant lipophilicity, potentially influencing its biological activity and solubility properties. The methoxy group attached to the phenyl ring enhances its reactivity and may contribute to its pharmacological profile. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for formulation and administration in pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and effects would depend on its molecular structure and the presence of functional groups, which can influence binding affinity and selectivity for biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₂H₁₅Cl₂NO·ClH

InChI: InChI=1S/C12H15Cl2NO.ClH/c13-11-4-1-5-12(14)10(11)8-16-7-9-3-2-6-15-9;/h1,4-5,9,15H,2-3,6-8H2;1H

InChI key: InChIKey=RZDHOTIKYZWAJE-UHFFFAOYSA-N

SMILES: C(OCC1CCCN1)C2=C(Cl)C=CC=C2Cl.Cl

Synonyms:

• Pyrrolidine, 2-[[(2,6-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)