
CAS 1289388-69-7
:3-Piperidinamine, 1-[(2,5-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-[(2,5-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a dichlorophenyl group indicates that the compound has two chlorine atoms substituted on a phenyl ring, specifically at the 2 and 5 positions, which can influence its biological activity and lipophilicity. The N-methyl substitution on the piperidine nitrogen enhances its basicity and may affect its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions, efficacy, and safety profile would depend on further empirical studies. Overall, the structural features suggest potential utility in drug development, particularly in areas targeting central nervous system disorders or other therapeutic areas where piperidine derivatives are known to be effective.
Formula:C13H18Cl2N2·ClH
InChI:InChI=1S/C13H18Cl2N2.ClH/c1-16-12-3-2-6-17(9-12)8-10-7-11(14)4-5-13(10)15;/h4-5,7,12,16H,2-3,6,8-9H2,1H3;1H
InChI key:InChIKey=OJUMKCMJGKRUCM-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=CC(Cl)=C1)N2CC(NC)CCC2.Cl
Synonyms:- 3-Piperidinamine, 1-[(2,5-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.