CAS 128942-39-2
:7-fluoro-4-oxo-4H-chromene-2-carboxylic acid
Description:
7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid is a chemical compound characterized by its chromene structure, which features a fused benzene and pyran ring. The presence of a fluorine atom at the 7-position contributes to its unique reactivity and potential biological activity. The compound contains a carboxylic acid functional group at the 2-position, which enhances its solubility in polar solvents and allows for potential interactions in biological systems. The keto group at the 4-position plays a crucial role in stabilizing the molecule and influencing its chemical behavior. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the environment and conditions under which it is studied. Overall, 7-fluoro-4-oxo-4H-chromene-2-carboxylic acid represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C10H5FO4
InChI:InChI=1/C10H5FO4/c11-5-1-2-6-7(12)4-9(10(13)14)15-8(6)3-5/h1-4H,(H,13,14)
SMILES:c1cc2c(=O)cc(C(=O)O)oc2cc1F
Synonyms:- 4H-1-benzopyran-2-carboxylic acid, 7-fluoro-4-oxo-
- 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid
- 7-Fluorochromone-2-carboxylic acid
- 7-Fluoro-4-oxo-1(4H)-benzopyran-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4H-1-Benzopyran-2-carboxylic acid, 7-fluoro-4-oxo-
CAS:Formula:C10H5FO4Purity:98%Color and Shape:SolidMolecular weight:208.14277-Fluoro-4-oxo-4H-chromene-2-carboxylic acid
CAS:7-Fluoro-4-oxo-4H-chromene-2-carboxylic acidPurity:98%Molecular weight:208.14g/mol7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid
CAS:Formula:C10H5FO4Purity:98%Color and Shape:SolidMolecular weight:208.1447-Fluorochromone-2-carboxylic acid
CAS:7-Fluorochromone-2-carboxylic acid is an enantiomer of 2-fluorochromone. It is a potent compound that has been shown to have significant reduction in the activity of the channel protein. This drug is orally active and is selective for animal models over other animals, such as rats and mice. 7-Fluorochromone-2-carboxylic acid binds with high affinity to the amine group of the chiral center of the class A GABAA receptor and exhibits potency by inhibiting amino acid uptake into cells in culture.
Formula:C10H5FO4Purity:Min. 95%Molecular weight:208.14 g/mol



