CAS 1289584-95-7

1,1-Dimethylethyl (3S)-3-[(3-methyl-2-pyrazinyl)amino]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl (3S)-3-[(3-methyl-2-pyrazinyl)amino]-1-pyrrolidinecarboxylate, identified by its CAS number 1289584-95-7, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a pyrazine moiety. This compound features a dimethyl substituent at the 1-position of the pyrrolidine, contributing to its steric properties and potentially influencing its biological activity. The presence of the pyrazinyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry at the 3-position of the pyrrolidine is specified as (3S), indicating a specific spatial arrangement that can affect the compound's reactivity and interactions. Additionally, the carboxylate functional group is likely to participate in hydrogen bonding and ionic interactions, enhancing its solubility and reactivity in various environments. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₄H₂₂N₄O₂

InChI: InChI=1S/C14H22N4O2/c1-10-12(16-7-6-15-10)17-11-5-8-18(9-11)13(19)20-14(2,3)4/h6-7,11H,5,8-9H2,1-4H3,(H,16,17)/t11-/m0/s1

InChI key: InChIKey=KRFPAHDRAVSHRW-NSHDSACASA-N

SMILES: N([C@@H]1CN(C(OC(C)(C)C)=O)CC1)C=2C(C)=NC=CN2

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-[(3-methyl-2-pyrazinyl)amino]-, 1,1-dimethylethyl ester, (3S)-
• 1,1-Dimethylethyl (3S)-3-[(3-methyl-2-pyrazinyl)amino]-1-pyrrolidinecarboxylate