CAS 1289585-09-6

(3S)-1-(2-Pyrazinyl)-3-pyrrolidinol

Description:

(3S)-1-(2-Pyrazinyl)-3-pyrrolidinol is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a pyrazine moiety. The presence of the pyrazine ring contributes to its potential biological activity, as heterocyclic compounds often exhibit diverse pharmacological properties. The stereochemistry indicated by the (3S) designation suggests that the compound has a specific three-dimensional arrangement, which can influence its interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a lead compound or scaffold for further modifications. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present in its structure. As with many organic compounds, the synthesis and characterization of (3S)-1-(2-Pyrazinyl)-3-pyrrolidinol would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its identity and purity. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₈H₁₁N₃O

InChI: InChI=1S/C8H11N3O/c12-7-1-4-11(6-7)8-5-9-2-3-10-8/h2-3,5,7,12H,1,4,6H2/t7-/m0/s1

InChI key: InChIKey=ZUFKVTACICNZEH-ZETCQYMHSA-N

SMILES: O[C@@H]1CN(CC1)C=2C=NC=CN2

Synonyms:

• 3-Pyrrolidinol, 1-(2-pyrazinyl)-, (3S)-
• (3S)-1-(2-Pyrazinyl)-3-pyrrolidinol