CymitQuimica logo

CAS 1289585-12-1

:

3-Pyrrolidinamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)-

Description:
3-Pyrrolidinamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine structure, which is a five-membered nitrogen-containing heterocycle. The presence of the 2,6-dichlorophenyl group indicates that the compound has significant lipophilicity, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, which is advantageous for pharmaceutical applications. The (3S)- designation suggests that the compound has a specific stereochemistry, which can be crucial for its interaction with biological targets, such as receptors or enzymes. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed information regarding its specific biological activity, toxicity, and therapeutic potential would require further investigation through experimental studies and literature review.
Formula:C11H14Cl2N2·ClH
InChI:InChI=1S/C11H14Cl2N2.ClH/c12-10-2-1-3-11(13)9(10)7-15-8-4-5-14-6-8;/h1-3,8,14-15H,4-7H2;1H/t8-;/m0./s1
InChI key:InChIKey=WPUMDLFYJMEUFM-QRPNPIFTSA-N
SMILES:C(N[C@H]1CCNC1)C2=C(Cl)C=CC=C2Cl.Cl
Synonyms:
  • 3-Pyrrolidinamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.