CAS 1289585-19-8
:(3S)-1-[(2-Chloro-6-fluorophenyl)methyl]-3-pyrrolidinol
Description:
(3S)-1-[(2-Chloro-6-fluorophenyl)methyl]-3-pyrrolidinol, with the CAS number 1289585-19-8, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, indicating potential for interactions typical of amines. The presence of a chloro and a fluorine substituent on the phenyl ring suggests that the compound may exhibit unique electronic properties and reactivity, potentially influencing its biological activity. The stereochemistry at the 3-position of the pyrrolidine indicates that it may have specific interactions in biological systems, which is crucial for pharmacological applications. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its solubility, stability, and reactivity would depend on the specific conditions and the presence of other functional groups. Overall, this compound represents a class of molecules that could have significant implications in drug design and development.
Formula:C11H13ClFNO
InChI:InChI=1S/C11H13ClFNO/c12-10-2-1-3-11(13)9(10)7-14-5-4-8(15)6-14/h1-3,8,15H,4-7H2/t8-/m0/s1
InChI key:InChIKey=JJSYMSMQHJJVSO-QMMMGPOBSA-N
SMILES:C(C1=C(Cl)C=CC=C1F)N2C[C@@H](O)CC2
Synonyms:- (3S)-1-[(2-Chloro-6-fluorophenyl)methyl]-3-pyrrolidinol
- 3-Pyrrolidinol, 1-[(2-chloro-6-fluorophenyl)methyl]-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.