CAS 1289585-21-2

3-Pyrrolidinamine, N-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1), (3R)-

Description:

3-Pyrrolidinamine, N-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. The presence of the 3,4-dichlorophenyl group indicates that the compound has significant aromatic characteristics, likely contributing to its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The (3R)- designation suggests that the compound has a specific stereochemistry, which can influence its interaction with biological targets, potentially affecting its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural features that could interact with various biological pathways. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₁H₁₄Cl₂N₂·ClH

InChI: InChI=1S/C11H14Cl2N2.ClH/c12-10-2-1-8(5-11(10)13)6-15-9-3-4-14-7-9;/h1-2,5,9,14-15H,3-4,6-7H2;1H/t9-;/m1./s1

InChI key: InChIKey=XAYDBZBYRCIIRB-SBSPUUFOSA-N

SMILES: C(N[C@@H]1CCNC1)C2=CC(Cl)=C(Cl)C=C2.Cl

Synonyms:

• 3-Pyrrolidinamine, N-[(3,4-dichlorophenyl)methyl]-, hydrochloride (1:1), (3R)-