CAS 1289585-24-5

3-Pyridinemethanamine, 6-chloro-N-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

3-Pyridinemethanamine, 6-chloro-N-(3R)-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its structural components, which include a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts, as indicated by its hydrochloride form. The presence of the chlorine atom at the 6-position of the pyridine ring may influence its reactivity and biological activity. The compound is likely to be soluble in polar solvents due to the presence of the hydrochloride group, which enhances its solubility in water. Its stereochemistry, indicated by the (3R) designation, suggests specific spatial arrangements that can affect its pharmacological properties. Compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry, due to their ability to interact with various biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₁₄ClN₃·ClH

InChI: InChI=1S/C10H14ClN3.ClH/c11-10-2-1-8(6-14-10)5-13-9-3-4-12-7-9;/h1-2,6,9,12-13H,3-5,7H2;1H/t9-;/m1./s1

InChI key: InChIKey=NTPWNWWMZLCTTN-SBSPUUFOSA-N

SMILES: C(N[C@@H]1CCNC1)C=2C=CC(Cl)=NC2.Cl

Synonyms:

• 3-Pyridinemethanamine, 6-chloro-N-(3R)-3-pyrrolidinyl-, hydrochloride (1:1)