CAS 1289585-28-9

Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1), (3S)-

Description:

Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2,4-dichlorophenyl group attached via a methoxy linkage contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The (3S)- designation indicates the specific stereochemistry at the pyrrolidine ring, which can influence the compound's interaction with biological targets, potentially affecting its pharmacological profile. This compound may exhibit various properties, including potential use as a therapeutic agent, but detailed studies would be necessary to elucidate its specific biological activities, mechanisms of action, and safety profile. As with many chemical substances, handling should be conducted with care, adhering to safety protocols due to potential toxicity or reactivity.

Formula: C₁₁H₁₃Cl₂NO·ClH

InChI: InChI=1S/C11H13Cl2NO.ClH/c12-9-2-1-8(11(13)5-9)7-15-10-3-4-14-6-10;/h1-2,5,10,14H,3-4,6-7H2;1H/t10-;/m0./s1

InChI key: InChIKey=GGNMWLWPDGQZSC-PPHPATTJSA-N

SMILES: C(O[C@H]1CCNC1)C2=C(Cl)C=C(Cl)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(2,4-dichlorophenyl)methoxy]-, hydrochloride (1:1), (3S)-