CymitQuimica logo

CAS 1289585-29-0

:

3-Pyrrolidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)-

Description:
3-Pyrrolidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. The presence of the 2,5-dichlorophenyl group indicates that the compound has significant aromatic characteristics, likely contributing to its biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its potential for pharmaceutical applications. The (3S)- designation refers to the specific stereochemistry of the molecule, indicating that it has a particular three-dimensional arrangement that may influence its interaction with biological targets. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological effects, although specific biological activities would require further investigation. Its CAS number, 1289585-29-0, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields.
Formula:C11H14Cl2N2·ClH
InChI:InChI=1S/C11H14Cl2N2.ClH/c12-9-1-2-11(13)8(5-9)6-15-10-3-4-14-7-10;/h1-2,5,10,14-15H,3-4,6-7H2;1H/t10-;/m0./s1
InChI key:InChIKey=VPCDQIPGWYBVOR-PPHPATTJSA-N
SMILES:C(N[C@H]1CCNC1)C2=C(Cl)C=CC(Cl)=C2.Cl
Synonyms:
  • 3-Pyrrolidinamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1), (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.