
CAS 1289585-42-7
:3-Pyrrolidinamine, N-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1), (3R)-
Description:
3-Pyrrolidinamine, N-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine structure, which is a five-membered ring containing nitrogen. The presence of the N-[(2-chloro-6-fluorophenyl)methyl] group indicates that it has a substituted aromatic ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can enhance its bioavailability. The (3R)- designation refers to the specific stereochemistry of the compound, indicating that it has a particular three-dimensional arrangement that may influence its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its characteristics, including solubility, stability, and reactivity, are influenced by both the pyrrolidine core and the substituted aromatic moiety, making it a subject of study in various chemical and biological applications.
Formula:C11H14ClFN2·ClH
InChI:InChI=1S/C11H14ClFN2.ClH/c12-10-2-1-3-11(13)9(10)7-15-8-4-5-14-6-8;/h1-3,8,14-15H,4-7H2;1H/t8-;/m1./s1
InChI key:InChIKey=KEKMADLBIVIMGK-DDWIOCJRSA-N
SMILES:C(N[C@@H]1CCNC1)C2=C(Cl)C=CC=C2F.Cl
Synonyms:- 3-Pyrrolidinamine, N-[(2-chloro-6-fluorophenyl)methyl]-, hydrochloride (1:1), (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.