CAS 128960-73-6
:L--Glutamyl-L-cysteinyl-L-lysine
Description:
L-Glutamyl-L-cysteinyl-L-lysine, identified by the CAS number 128960-73-6, is a synthetic peptide composed of three amino acids: glutamic acid, cysteine, and lysine. This compound exhibits characteristics typical of peptides, including the ability to form hydrogen bonds and engage in various interactions due to its polar and charged side chains. The presence of cysteine allows for potential disulfide bond formation, which can influence the peptide's stability and conformation. L-Glutamyl-L-cysteinyl-L-lysine may exhibit biological activity, potentially acting as a signaling molecule or playing a role in cellular processes. Its solubility in water is generally high, given the polar nature of its constituent amino acids. Additionally, the peptide's structure may allow it to participate in enzyme-substrate interactions or serve as a substrate for post-translational modifications. Overall, this compound's unique combination of amino acids contributes to its potential applications in biochemistry and pharmaceuticals, particularly in the context of peptide-based therapeutics.
Formula:C14H26N4O6S
InChI:InChI=1/C14H26N4O6S/c15-6-2-1-3-9(14(23)24)18-12(20)10(7-25)17-11(19)5-4-8(16)13(21)22/h8-10,25H,1-7,15-16H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24)/t8-,9-,10-/m0/s1
SMILES:C(CCN)C[C@@H](C(=O)O)N=C([C@H](CS)N=C(CC[C@@H](C(=O)O)N)O)O
Synonyms:- N2-(N-L--Glutamyl-L-cysteinyl)-L-lysine
- L-γ-glutamyl-L-cysteinyl-L-lysine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-γ-Glutamyl-L-cysteinyl-L-lysine
CAS:Formula:C14H26N4O6SColor and Shape:SolidMolecular weight:378.4444L-γ-Glutamyl-L-cysteinyl-L-lysine-13C5,15N
CAS:Controlled ProductFormula:C5C9H2615NN3O6SColor and Shape:NeatMolecular weight:384.401L-gamma-Glutamyl-L-cysteinyl-L-lysine trifluoroacetate
CAS:L-gamma-Glutamyl-L-cysteinyl-L-lysine (GLC) is an antioxidant and a component of the human antiserum. It has been shown to have a symmetric, homologous structure that contains four amino acids: L-glutamic acid, L-cysteine, L-lysine, and glycine. GLC has also been shown to be a part of collagen gel with the ability to transfer collagen molecules. This protein is encoded by the gene CGL1 and is found in hamsters.Formula:C14H26N4O6S•(C2HF3O2)xPurity:Min. 95%Color and Shape:White PowderMolecular weight:378.45 g/mol



