CAS 1289626-24-9

4-Bromo-2-methoxybenzeneethanol

Description:

4-Bromo-2-methoxybenzeneethanol, identified by its CAS number 1289626-24-9, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a benzene ring, along with an ethanol functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in organic synthesis. The methoxy group contributes to the compound's solubility in organic solvents and can influence its electronic properties, potentially affecting its reactivity and interaction with other chemical species. Additionally, the presence of the hydroxyl group in the ethanol moiety suggests that the compound may exhibit hydrogen bonding capabilities, which can influence its physical properties, such as boiling point and solubility in polar solvents. Overall, 4-Bromo-2-methoxybenzeneethanol is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science.

Formula: C₉H₁₁BrO₂

InChI: InChI=1S/C9H11BrO2/c1-12-9-6-8(10)3-2-7(9)4-5-11/h2-3,6,11H,4-5H2,1H3

InChI key: InChIKey=MGVQTXCVWWQCRT-UHFFFAOYSA-N

SMILES: C(CO)C1=C(OC)C=C(Br)C=C1

Synonyms:

• 2-(4-Bromo-2-methoxyphenyl)ethan-1-ol
• 2-(4-Bromo-2-methoxyphenyl)ethanol
• Benzeneethanol, 4-bromo-2-methoxy-
• 4-Bromo-2-methoxybenzeneethanol