CAS 129-02-2
:8-Amino-1-naphthalenecarboxylic acid
Description:
8-Amino-1-naphthalenecarboxylic acid, also known as 8-amino-α-naphthoic acid, is an organic compound characterized by its naphthalene structure with an amino group and a carboxylic acid functional group. This compound appears as a crystalline solid and is typically soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including amide formation and coupling reactions. The amino group can act as a nucleophile, while the carboxylic acid can serve as an electrophile. This compound is often used in the synthesis of dyes, pharmaceuticals, and as a reagent in organic chemistry. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, which can be explored in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c12-9-6-2-4-7-3-1-5-8(10(7)9)11(13)14/h1-6H,12H2,(H,13,14)
InChI key:InChIKey=OXTCGCGDPOLJDV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C=CC=C2N)C=CC1
Synonyms:- 1-Naphthoic acid, 8-amino-
- 8-Amino-1-naphthalenecarboxylic acid
- 1-Amino-8-naphthoic acid
- 1-Naphthalenecarboxylic acid, 8-amino-
- 8-Amino-1-naphthoic acid
- 8-Amino-naphthalene-1-carboxylic acid
- 8-AMINO-1-NAPHTHOICACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
