
CAS 129-37-3
:9,10-Dihydro-8-nitro-9,10-dioxo-1-anthracenesulfonic acid
Description:
9,10-Dihydro-8-nitro-9,10-dioxo-1-anthracenesulfonic acid, with CAS number 129-37-3, is an organic compound that belongs to the class of anthraquinone derivatives. This substance is characterized by its complex aromatic structure, which includes a nitro group and sulfonic acid functionality, contributing to its solubility in water and potential reactivity. The presence of the dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical reactions, including reduction and nucleophilic attacks. The sulfonic acid group enhances its polarity, making it useful in applications such as dyes, pigments, and as a reagent in organic synthesis. Additionally, the nitro group can serve as a site for further chemical modifications. Overall, this compound exhibits properties typical of anthraquinone derivatives, including potential applications in the textile and pharmaceutical industries, as well as in research settings for studying electron transfer and redox processes. Safety and handling precautions should be observed due to its potential toxicity and environmental impact.
Formula:C14H7NO7S
InChI:InChI=1S/C14H7NO7S/c16-13-7-3-1-5-9(15(18)19)11(7)14(17)12-8(13)4-2-6-10(12)23(20,21)22/h1-6H,(H,20,21,22)
InChI key:InChIKey=VGIVZECXTZAEHI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(N(=O)=O)C=CC3)=CC=CC2S(=O)(=O)O
Synonyms:- 8-Nitro-1-anthraquinonesulfonic acid
- 9,10-Dihydro-8-nitro-9,10-dioxo-1-anthracenesulfonic acid
- 1-Nitro-8-sulfoanthraquinone
- 1-Anthracenesulfonic acid, 9,10-dihydro-8-nitro-9,10-dioxo-
- 1-Anthraquinonesulfonic acid, 8-nitro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Anthracenesulfonic acid, 9,10-dihydro-8-nitro-9,10-dioxo-
CAS:Formula:C14H7NO7SMolecular weight:333.2729
