CAS 129-63-5
:Acetrizoate sodium
Description:
Acetrizoate sodium, with the CAS number 129-63-5, is a chemical compound primarily used as a radiopaque agent in medical imaging, particularly in X-ray and CT scans. It is a sodium salt of acetrizoic acid, which belongs to the class of iodinated contrast media. This compound is characterized by its ability to absorb X-rays, enhancing the contrast of images obtained during diagnostic procedures. Acetrizoate sodium is typically a white to off-white crystalline powder that is soluble in water, making it suitable for intravenous administration. Its molecular structure includes iodine, which is responsible for its radiopacity. The compound is generally well-tolerated, but like all contrast agents, it may cause allergic reactions in some individuals. Additionally, it is important to consider its pharmacokinetics, as it is rapidly excreted by the kidneys. Overall, acetrizoate sodium plays a crucial role in enhancing the visibility of internal structures during imaging, aiding in accurate diagnosis and treatment planning.
Formula:C9H6I3NO3·Na
InChI:InChI=1S/C9H6I3NO3.Na/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16;/h2H,1H3,(H,13,14)(H,15,16);
InChI key:InChIKey=IMQJLPNDTJXCKK-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(I)C(C(O)=O)=C(I)C=C1I.[Na]
Synonyms:- Benzoic acid, 3-acetamido-2,4,6-triiodo-, sodium salt
- Benzoic acid, 3-(acetylamino)-2,4,6-triiodo-, sodium salt (1:1)
- MP 1023
- Benzoic acid, 3-(acetylamino)-2,4,6-triiodo-, monosodium salt
- Benzoic acid, 3-acetamido-2,4,6-triiodo-, monosodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetrizoate sodium
CAS:Acetrizoate sodium, known as the sodium salt of acetrizoic acid,can be used as a high-osmolality, water-soluble, iodinated radiographic contrast medium.Formula:C9H5I3NNaO3Color and Shape:SolidMolecular weight:578.84
