CymitQuimica logo

CAS 129-65-7

:

1,3-Dihydro-4,10-dihydroxy-8-methyl-3-oxoisobenzofuro[5,4-b]benzofuran-7-carboxylic acid

Description:
1,3-Dihydro-4,10-dihydroxy-8-methyl-3-oxoisobenzofuro[5,4-b]benzofuran-7-carboxylic acid, with the CAS number 129-65-7, is a complex organic compound characterized by its unique fused ring structure, which includes both benzofuran and isobenzofuran moieties. This compound features multiple functional groups, including hydroxyl (-OH) and carboxylic acid (-COOH) groups, contributing to its potential reactivity and solubility in various solvents. The presence of these functional groups suggests that it may exhibit acidic properties and could participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the methyl group attached to the structure may affect its steric properties and overall stability. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or reference to specialized chemical databases.
Formula:C16H10O7
InChI:InChI=1S/C16H10O7/c1-5-2-7(17)13-12-6-4-22-16(21)11(6)8(18)3-9(12)23-14(13)10(5)15(19)20/h2-3,17-18H,4H2,1H3,(H,19,20)
InChI key:InChIKey=QZYZPZAPRHESDA-UHFFFAOYSA-N
SMILES:OC1=C2C=3C4=C(C(O)=CC3OC2=C(C(O)=O)C(C)=C1)C(=O)OC4
Synonyms:
  • 1,3-Dihydro-4,10-dihydroxy-8-methyl-3-oxoisobenzofuro[5,4-b]benzofuran-7-carboxylic acid
  • 1,7-Dihydroxy-9-hydroxymethyl-3-methyl-4,8-dibenzofurandicarboxylic acid (8,9)-γ-lactone
  • Porphyrillic acid
  • Porphyrilic acid
  • Isobenzofuro[5,4-b]benzofuran-7-carboxylic acid, 1,3-dihydro-4,10-dihydroxy-8-methyl-3-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.