CymitQuimica logo

CAS 129-68-0

:

Aceanthryleno[2,1-a]aceanthrylene-5,13-dione

Description:
Aceanthryleno[2,1-a]aceanthrylene-5,13-dione, with the CAS number 129-68-0, is a polycyclic aromatic compound characterized by its complex fused ring structure. This compound features a dione functional group, which contributes to its reactivity and potential applications in organic synthesis and materials science. It typically exhibits strong UV-Vis absorption properties, making it of interest in photonic applications. The presence of multiple aromatic rings often leads to significant stability and hydrophobic characteristics, influencing its solubility in various solvents. Additionally, due to its structural features, it may exhibit interesting electronic properties, which can be harnessed in organic electronics or as a dye. Safety considerations are important, as many polycyclic aromatic compounds can be hazardous, necessitating careful handling and disposal. Overall, Aceanthryleno[2,1-a]aceanthrylene-5,13-dione is a notable compound in the field of organic chemistry, with potential implications in various research and industrial applications.
Formula:C30H14O2
InChI:InChI=1S/C30H14O2/c31-29-17-9-3-1-7-15(17)25-23-19(11-5-13-21(23)29)28-26-16-8-2-4-10-18(16)30(32)22-14-6-12-20(24(22)26)27(25)28/h1-14H
InChI key:InChIKey=NUNPDAMQSBMCIG-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=4C(C5=C6C4C=CC=C6C(=O)C=7C5=CC=CC7)=C3C=CC2)C=8C1=CC=CC8
Synonyms:
  • Aceanthryleno[2,1-a]aceanthrylene-5,13-dione
  • Acedianthrone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.