
CAS 129-93-1
:6,8-Bis(phenylamino)-1-naphthalenesulfonic acid
Description:
6,8-Bis(phenylamino)-1-naphthalenesulfonic acid, with the CAS number 129-93-1, is an organic compound characterized by its sulfonic acid functional group and two phenylamino substituents attached to a naphthalene backbone. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar sulfonic acid group. It is known for its application as a dye intermediate and in the synthesis of various organic compounds, particularly in the textile and paper industries. The presence of the sulfonic acid group enhances its water solubility and reactivity, making it useful in various chemical reactions. Additionally, the phenylamino groups contribute to its electronic properties, which can influence its behavior in dyeing processes. Safety considerations should be taken into account, as it may pose health risks upon exposure, necessitating proper handling and storage protocols. Overall, 6,8-Bis(phenylamino)-1-naphthalenesulfonic acid is a significant compound in organic chemistry with diverse industrial applications.
Formula:C22H18N2O3S
InChI:InChI=1S/C22H18N2O3S/c25-28(26,27)21-13-7-8-16-14-19(23-17-9-3-1-4-10-17)15-20(22(16)21)24-18-11-5-2-6-12-18/h1-15,23-24H,(H,25,26,27)
InChI key:InChIKey=USFSONWQSVCJBO-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(NC3=CC=CC=C3)C1)C=CC=C2S(=O)(=O)O)C4=CC=CC=C4
Synonyms:- 6,8-Bis(phenylamino)-1-naphthalenesulfonic acid
- 1-Naphthalenesulfonic acid, 6,8-dianilino-
- 1-Naphthalenesulfonic acid, 6,8-bis(phenylamino)-
- 6,8-Diphenylamino-1-naphthalenesulfonic acid
- 6,8-Dianilino-1-naphthalenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
