CAS 129000-35-7
:11-(2-fluoroethyl)estradiol
Description:
11-(2-Fluoroethyl)estradiol is a synthetic derivative of estradiol, which is a naturally occurring estrogen steroid hormone. This compound features a 2-fluoroethyl group at the 11-position of the estradiol structure, which modifies its biological activity and pharmacokinetic properties. The presence of the fluorine atom can enhance the compound's stability and alter its interaction with estrogen receptors. Typically, such modifications are explored for potential therapeutic applications, particularly in hormone-related conditions or cancers. The molecular structure of 11-(2-fluoroethyl)estradiol allows it to exhibit estrogenic activity, which can be assessed through various biological assays. Its CAS number, 129000-35-7, is a unique identifier that facilitates the tracking and study of this specific chemical in scientific literature and databases. As with many synthetic hormones, understanding its characteristics, including solubility, stability, and receptor affinity, is crucial for evaluating its potential uses in medicine and research.
Formula:C20H27FO2
InChI:InChI=1/C20H27FO2/c1-20-11-13(8-9-21)19-15-5-3-14(22)10-12(15)2-4-16(19)17(20)6-7-18(20)23/h3,5,10,13,16-19,22-23H,2,4,6-9,11H2,1H3/t13-,16-,17-,18-,19+,20-/m0/s1
Synonyms:- (11beta,17beta)-11-(2-Fluoroethyl)estra-1,3,5(10)-triene-3,17-diol
- 11-(2-Fluoroethyl)estra-1,3,5(10)-triene-3,17-diol
- Fets
- Estra-1,3,5(10)-triene-3,17-diol, 11-(2-fluoroethyl)-, (11beta,17beta)-
- 11-(2-Fluoroethyl)estradiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(8S,9S,11R,13S,14S,17S)-11-(2-Fluoroethyl)-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[a]Phenanthrene-3,17-Diol
CAS:Controlled Product(8S,9S,11R,13S,14S,17S)-11-(2-Fluoroethyl)-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[a]Phenanthrene-3,17-Diol is a light emitting diode (LED) that emits light in the near infrared spectrum. This LED is composed of a single layer of CdTe nanowires and has an emission wavelength of 760 nm. It also has a high quantum efficiency and low energy requirements for fabrication. The lifetime of this device is also long and its optical properties are stable over time. This device can be used to replace traditional incandescent bulbs or to emit light in specific wavelengths for biomedical applications.Formula:C20H27FO2Purity:Min. 95%Molecular weight:318.43 g/mol
