CAS 1290046-62-6

1,1-Dimethylethyl 4-(1-aminopropyl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(1-aminopropyl)-1-piperidinecarboxylate, identified by its CAS number 1290046-62-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with a carboxylate group and an aminopropyl chain. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, potentially influencing its reactivity and interaction with biological targets. The compound may exhibit properties typical of piperidine derivatives, such as potential pharmacological activity, making it of interest in medicinal chemistry. Its structure suggests it could participate in hydrogen bonding and other intermolecular interactions due to the presence of the amino and carboxylate functional groups. However, specific physical and chemical properties such as solubility, melting point, and stability would require empirical data for precise characterization. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₃H₂₆N₂O₂

InChI: InChI=1S/C13H26N2O2/c1-5-11(14)10-6-8-15(9-7-10)12(16)17-13(2,3)4/h10-11H,5-9,14H2,1-4H3

InChI key: InChIKey=PMAWBAFHGHQTEJ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(C(CC)N)CC1

Synonyms:

• 1,1-Dimethylethyl 4-(1-aminopropyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-(1-aminopropyl)-, 1,1-dimethylethyl ester