CAS 129009-83-2
:Versetamide
Description:
Versetamide, identified by its CAS number 129009-83-2, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which typically include a carbonyl group (C=O) bonded to a nitrogen atom (N), making it a derivative of a carboxylic acid. Versetamide is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. The compound may exhibit specific solubility properties, stability under certain conditions, and reactivity that can be influenced by the presence of functional groups. Additionally, its safety profile and environmental impact are important considerations in its use and handling. As with many chemical substances, understanding its characteristics, including molecular weight, boiling point, and potential toxicity, is crucial for researchers and industry professionals working with or studying this compound.
Formula:C20H37N5O10
InChI:InChI=1/C20H37N5O10/c1-34-9-3-21-16(26)11-24(14-19(30)31)7-5-23(13-18(28)29)6-8-25(15-20(32)33)12-17(27)22-4-10-35-2/h3-15H2,1-2H3,(H,21,26)(H,22,27)(H,28,29)(H,30,31)(H,32,33)
SMILES:COCCN=C(CN(CCN(CCN(CC(=NCCOC)O)CC(=O)O)CC(=O)O)CC(=O)O)O
Synonyms:- 8,11-Bis(carboxymethyl)-14-(2-((2-methoxyethyl)amino)-2-oxoethyl)-6-oxo-2-oxa-5,8,11,14-tetraazahexadecan-16-oic Acid
- Mp1196
- N,N-Bis[2-[(carboxymethyl)[[(2-methoxyethyl)carbamoyl]methyl]amino]ethyl]glycine
- N,N-Bis{2-[(carboxymethyl){2-[(2-methoxyethyl)amino]-2-oxoethyl}amino]ethyl}glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
15-Oxa-3,6,9,12-tetraazahexadecanoic acid, 6,9-bis(carboxymethyl)-3-[2-[(2-methoxyethyl)amino]-2-oxoethyl]-11-oxo-
CAS:Formula:C20H37N5O10Molecular weight:507.5353

