
CAS 1290136-86-5
:(2-Bromo-5-thiazolyl)(4-fluoro-1-piperidinyl)methanone
Description:
(2-Bromo-5-thiazolyl)(4-fluoro-1-piperidinyl)methanone is a chemical compound characterized by its unique structural features, which include a thiazole ring and a piperidine moiety. The presence of a bromine atom at the 2-position of the thiazole and a fluorine atom at the 4-position of the piperidine contributes to its reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the electronegative halogen substituents, which can influence its solubility in various solvents. The methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial or anticancer activities. The specific interactions and stability of this compound can be influenced by its molecular geometry and electronic properties, making it a subject of interest for further research in drug development and synthetic chemistry.
Formula:C9H10BrFN2OS
InChI:InChI=1S/C9H10BrFN2OS/c10-9-12-5-7(15-9)8(14)13-3-1-6(11)2-4-13/h5-6H,1-4H2
InChI key:InChIKey=BWGSHXFPYJMQJM-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(Br)=NC1)N2CCC(F)CC2
Synonyms:- 1-(2-Bromo-1,3-thiazole-5-carbonyl)-4-fluoropiperidine
- Methanone, (2-bromo-5-thiazolyl)(4-fluoro-1-piperidinyl)-
- (2-Bromo-5-thiazolyl)(4-fluoro-1-piperidinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2-Bromothiazol-5-yl)(4-fluoropiperidin-1-yl)methanone
CAS:Formula:C9H10BrFN2OSMolecular weight:293.1559
