CymitQuimica logo

CAS 1290136-87-6

:

(2-Bromo-5-thiazolyl)(3-fluoro-1-piperidinyl)methanone

Description:
(2-Bromo-5-thiazolyl)(3-fluoro-1-piperidinyl)methanone is a chemical compound characterized by its unique structural features, which include a thiazole ring and a piperidine moiety. The presence of a bromine atom at the 2-position of the thiazole and a fluorine atom at the 3-position of the piperidine contributes to its reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the electronegative halogen substituents, which can influence its solubility in various solvents. The methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, such as nucleophilic additions. Given its structural complexity, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific interactions and efficacy would depend on further studies, including its synthesis, stability, and biological assays. Overall, (2-Bromo-5-thiazolyl)(3-fluoro-1-piperidinyl)methanone represents a compound of interest in the field of organic and medicinal chemistry.
Formula:C9H10BrFN2OS
InChI:InChI=1S/C9H10BrFN2OS/c10-9-12-4-7(15-9)8(14)13-3-1-2-6(11)5-13/h4,6H,1-3,5H2
InChI key:InChIKey=JQUVFURGQIFCAU-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(F)CCC1)C2=CN=C(Br)S2
Synonyms:
  • (2-Bromo-5-thiazolyl)(3-fluoro-1-piperidinyl)methanone
  • Methanone, (2-bromo-5-thiazolyl)(3-fluoro-1-piperidinyl)-
  • (2-Bromo-1,3-thiazol-5-yl)-(3-fluoropiperidin-1-yl)methanone
  • 1-(2-Bromo-1,3-thiazole-5-carbonyl)-3-fluoropiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.