CymitQuimica logo

CAS 1290136-89-8

:

1,1-Dimethylethyl 3-(4-morpholinyl)-1-azetidinecarboxylate

Description:
1,1-Dimethylethyl 3-(4-morpholinyl)-1-azetidinecarboxylate, identified by its CAS number 1290136-89-8, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and a morpholine moiety, contributing to its potential biological activity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, which may influence its solubility and permeability in biological systems. This compound is likely to exhibit specific pharmacological properties due to the combination of the azetidine and morpholine functionalities, which are often associated with various therapeutic effects. Additionally, the ester functional group in the structure suggests potential reactivity, making it a candidate for further chemical modifications. Overall, the characteristics of this compound position it as a subject of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-12(2,3)17-11(15)14-8-10(9-14)13-4-6-16-7-5-13/h10H,4-9H2,1-3H3
InChI key:InChIKey=QQLOZRROQTZROD-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C1)N2CCOCC2
Synonyms:
  • 1,1-Dimethylethyl 3-(4-morpholinyl)-1-azetidinecarboxylate
  • tert-Butyl 3-morpholinoazetidine-1-carboxylate
  • 1-Azetidinecarboxylic acid, 3-(4-morpholinyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.