CAS 129018-59-3

1-Methyl-2-nitro-6-phenylimidazo[4,5-B]pyridine

Description:

1-Methyl-2-nitro-6-phenylimidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes an imidazo ring fused with a pyridine ring. This compound features a methyl group and a nitro group, contributing to its chemical reactivity and potential biological activity. The presence of the phenyl group enhances its aromatic character, which can influence its solubility and interaction with other molecules. Typically, compounds of this type are studied for their potential roles in biological systems, including their mutagenic and carcinogenic properties, as they may be formed during the cooking of certain foods. The nitro group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Additionally, its unique structure may allow for specific interactions with biological targets, warranting further investigation in pharmacology and toxicology. Overall, 1-Methyl-2-nitro-6-phenylimidazo[4,5-b]pyridine exemplifies the complexity and diversity of heterocyclic compounds in chemical research.

Formula: C₁₃H₁₀N₄O₂

InChI: InChI=1/C13H10N4O2/c1-16-11-7-10(9-5-3-2-4-6-9)8-14-12(11)15-13(16)17(18)19/h2-8H,1H3

SMILES: Cn1c2cc(cnc2nc1N(=O)=O)c1ccccc1

Synonyms:

• 2-Nitro-1-Methyl-6-Phenylimidazo(4,5-B)Pyridine
• 1-methyl-2-nitro-6-phenyl-1H-imidazo[4,5-b]pyridine

1H-Imidazo[4,5-b]pyridine, 1-methyl-2-nitro-6-phenyl-

CAS: 129018-59-3

Formula: C₁₃H₁₀N₄O₂

Color and Shape: Solid

Molecular weight: 254.2441

Ref: IN-DA000YSZ