CymitQuimica logo

CAS 129018-80-0

:

5-Amino-2-[2-(methylamino)ethoxy]benzoic acid

Description:
5-Amino-2-[2-(methylamino)ethoxy]benzoic acid, with the CAS number 129018-80-0, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group and an ethoxy group containing a methylamino substituent. This compound typically exhibits properties such as solubility in polar solvents due to the presence of both amino and carboxylic acid functional groups, which can engage in hydrogen bonding. The amino group contributes to its basicity, while the carboxylic acid imparts acidic characteristics. The ethoxy group enhances its hydrophilicity, making it more soluble in aqueous environments. This compound may be of interest in pharmaceutical research, particularly in the development of drug candidates, due to its potential biological activity. Its structural features suggest it could interact with biological targets, making it a candidate for further investigation in medicinal chemistry. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C10H14N2O3
InChI:InChI=1S/C10H14N2O3/c1-12-4-5-15-9-3-2-7(11)6-8(9)10(13)14/h2-3,6,12H,4-5,11H2,1H3,(H,13,14)
InChI key:InChIKey=HEOZIEYPTOWDLF-UHFFFAOYSA-N
SMILES:O(CCNC)C1=C(C(O)=O)C=C(N)C=C1
Synonyms:
  • 5-Amino-2-[2-(methylamino)ethoxy]benzoic acid
  • Benzoic acid, 5-amino-2-[2-(methylamino)ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.