CAS 129024-87-9

(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide

Description:

The chemical substance known as "(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide," with the CAS number 129024-87-9, is a complex organic compound characterized by its long-chain polyunsaturated fatty acid structure, specifically a docosahexaenoic acid (DHA) derivative. This compound features multiple double bonds in its carbon chain, which contributes to its unsaturated nature and potential biological activity. The presence of the 3,4-dihydroxyphenyl group suggests antioxidant properties, as phenolic compounds are known for their ability to scavenge free radicals. The amide functional group indicates that this molecule may participate in various biochemical interactions, potentially influencing cellular signaling pathways. Its structural configuration, denoted by the Z (cis) notation, implies specific spatial arrangements that can affect its reactivity and interactions with biological systems. Overall, this compound may have implications in nutritional biochemistry and pharmacology, particularly in the context of cardiovascular health and neuroprotection, although further research would be necessary to elucidate its specific biological roles and therapeutic potential.

Formula: C₃₀H₄₁NO₃

InChI: InChI=1/C30H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-30(34)31-25-24-27-22-23-28(32)29(33)26-27/h3-4,6-7,9-10,12-13,15-16,18-19,22-23,26,32-33H,2,5,8,11,14,17,20-21,24-25H2,1H3,(H,31,34)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=NCCc1ccc(c(c1)O)O)O

Synonyms:

• 4,7,10,13,16,19-docosahexaenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]-, (4Z,7Z,10Z,13Z,16Z,19Z)-

NMI 8739

CAS: 129024-87-9

NMI 8739

Purity: ≥98%

Molecular weight: 463.65g/mol

Ref: 54-BUP12049

NMI 8739

CAS: 129024-87-9

NMI 8739 (n-docosahexaenoyl dopamine) is an agonist of D2 autoreceptor.

Formula: C₃₀H₄₁NO₃

Purity: 98.51%

Color and Shape: Solid

Molecular weight: 463.65

Ref: TM-T11079