CAS 129025-96-3

3-(β-D-Glucopyranosyloxy)-1,7-dihydroxy-2,8-dimethoxy-6-methyl-9,10-anthracenedione

Description:

3-(β-D-Glucopyranosyloxy)-1,7-dihydroxy-2,8-dimethoxy-6-methyl-9,10-anthracenedione, with the CAS number 129025-96-3, is a chemical compound that belongs to the class of anthraquinones, which are characterized by their polycyclic aromatic structure and the presence of two carbonyl groups. This compound features a glucopyranosyl moiety, indicating that it has a sugar component that can enhance its solubility and biological activity. The presence of multiple hydroxyl and methoxy groups contributes to its potential reactivity and solubility in various solvents. The specific arrangement of these functional groups can influence its pharmacological properties, making it of interest in medicinal chemistry. Additionally, anthraquinones are known for their applications in dyes, pigments, and as potential therapeutic agents due to their ability to interact with biological systems. Overall, this compound's unique structure suggests potential utility in various fields, including pharmaceuticals and biochemistry, although specific biological activities would require further investigation.

Formula: C₂₃H₂₄O₁₂

InChI: InChI=1S/C23H24O12/c1-7-4-8-13(22(33-3)14(7)25)17(28)12-9(15(8)26)5-10(21(32-2)18(12)29)34-23-20(31)19(30)16(27)11(6-24)35-23/h4-5,11,16,19-20,23-25,27,29-31H,6H2,1-3H3/t11-,16-,19+,20-,23-/m1/s1

InChI key: InChIKey=LQYQYAJWKXDTHR-PHVGODQESA-N

SMILES: O=C1C=2C(C(=O)C=3C1=CC(C)=C(O)C3OC)=C(O)C(OC)=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C2

Synonyms:

• Glucoaurantio-obtusin
• 9,10-Anthracenedione, 3-(β-D-glucopyranosyloxy)-1,7-dihydroxy-2,8-dimethoxy-6-methyl-
• 3-(β-D-Glucopyranosyloxy)-1,7-dihydroxy-2,8-dimethoxy-6-methyl-9,10-anthracenedione

Aurantio-obtusin β-D-glucoside

CAS: 129025-96-3

Aurantio-obtusin β-D-glucoside

Purity: ≥98%

Molecular weight: 492.43g/mol

Ref: 54-BUP07400

Aurantio-obtusin β-D-glucoside

CAS: 129025-96-3

Formula: C₂₃H₂₄O₁₂

Molecular weight: 492.43

Ref: 7W-GY0288

Aurantio-obtusin β-D-glucoside

CAS: 129025-96-3

Formula: C₂₃H₂₄O₁₂

Purity: 95%~99%

Molecular weight: 492.433

Ref: BP-BP4013

Aurantio-obtusin β-D-glucoside

CAS: 129025-96-3

Aurantio-obtusin β-D-glucoside (Aurantio-obtusin beta-D-glucoside) is a natural product originated from the enzymatic cleavage of its glucoside glucoaurantio-

Formula: C₂₃H₂₄O₁₂

Purity: 99.76% - 99.89%

Color and Shape: Solid

Molecular weight: 492.43

Ref: TM-TN1414

Aurantio-obtusin β-D-glucoside

CAS: 129025-96-3

Aurantio-obtusin β-D-glucoside is a naturally occurring compound that belongs to the class of anthraquinone glucosides. It is sourced primarily from various traditional medicinal plants, known for their therapeutic potential, including species within the genus **Cassia**. This compound acts through modulation of specific biological pathways, often exhibiting effects such as anti-inflammatory and hepatoprotective activities.

Formula: C₂₃H₂₄O₁₂

Purity: Min. 95%

Molecular weight: 492.4 g/mol

Ref: 3D-EFA02596