CAS 129033-04-1
:cyclotheonamide A
Description:
Cyclotheonamide A is a naturally occurring compound classified as a cyclic peptide, specifically derived from marine organisms, particularly certain species of sponges. It exhibits a unique structure characterized by a cyclic arrangement of amino acids, which contributes to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic effects. Cyclotheonamide A has been studied for its ability to inhibit specific enzymes and cellular processes, making it a candidate for further research in drug development. Its complex structure and the presence of various functional groups may also influence its solubility and reactivity, which are important factors in its biological activity. As with many natural products, the extraction and synthesis of cyclotheonamide A can be challenging, but advancements in synthetic methodologies continue to enhance accessibility for research purposes. Overall, cyclotheonamide A represents a fascinating area of study within the realm of natural product chemistry and its applications in therapeutics.
Formula:C36H45N9O8
InChI:InChI=1/C36H45N9O8/c37-36(38)39-16-4-8-26-31(49)34(52)44-27(19-22-6-2-1-3-7-22)32(50)42-24(18-23-10-13-25(47)14-11-23)12-15-30(48)40-20-28(41-21-46)35(53)45-17-5-9-29(45)33(51)43-26/h1-3,6-7,10-15,21,24,26-29,47H,4-5,8-9,16-20H2,(H,40,48)(H,41,46)(H,42,50)(H,43,51)(H,44,52)(H4,37,38,39)/b15-12+/t24-,26+,27-,28+,29+/m1/s1
Synonyms:- 3-((4-Amino-5-(4-hydroxyphenyl)-1-oxo-2-pentenyl)amino)-N-formyl-L-alanyl-D-prolyl-6-((aminoiminomethyl)amino)-2-oxo-3-aminohexanoyl-L-phenylalanine cyclic (4-1)-peptide
- L-Phenylalanine, 3-((4-amino-5-(4-hydroxyphenyl)-1-oxo-2-pentenyl)amino)-N-formyl-L-alanyl-D-prolyl-6-((aminoiminomethyl)amino)-2-oxo-3-aminohexanoyl-, cyclic (4-1)-peptide
- 2-{3-[(3S,7R,10S,11E,16S,21aS)-7-benzyl-16-(formylamino)-10-(4-hydroxybenzyl)-1,4,5,8,13,17-hexaoxo-2,3,4,5,6,7,8,9,10,13,14,15,16,17,19,20,21,21a-octadecahydro-1H-pyrrolo[2,1-j][1,4,8,11,15]pentaazacyclononadecin-3-yl]propyl}guanidine
- Cyclotheonamide A
- Cyclo[(2S)-2-(formylamino)-β-alanyl-L-prolyl-(3S)-3-amino-6-[(aminoiminomethyl)amino]-2-oxohexanoyl-D-phenylalanyl-(2E,4S)-4-amino-5-(4-hydroxyphenyl)-2-pentenoyl]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cyclotheonamide A
CAS:Cyclotheonamide A is a cyclic peptide isolated from the marine sponge Theonella.
Formula:C36H45N9O8Color and Shape:SolidMolecular weight:731.8Cyclotheonamide A
CAS:Cyclotheonamide A is a cyclopeptide, which is a type of secondary metabolite composed of non-standard amino acids arranged in a cyclic structure. It is naturally sourced from marine sponges, particularly Theonella sp., which are known for their rich and diverse repertoire of bioactive compounds. Cyclotheonamide A functions through the inhibition of serine proteases, a class of enzymes that play a significant role in numerous biological processes, including digestion, immune response, and blood coagulation.Formula:C36H45N9O8Purity:Min. 95%Molecular weight:731.8 g/mol

