CymitQuimica logo

CAS 129041-16-3

:

4-[bis(naphthalen-1-ylmethyl)amino]butanoic acid

Description:
4-[Bis(naphthalen-1-ylmethyl)amino]butanoic acid, identified by its CAS number 129041-16-3, is an organic compound characterized by its unique structure that includes a butanoic acid moiety and two naphthylmethyl groups attached to a central nitrogen atom. This compound exhibits properties typical of amino acids, such as the ability to form hydrogen bonds due to the presence of both an amino group and a carboxylic acid group. The naphthyl groups contribute to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The presence of multiple aromatic rings may also impart significant stability and contribute to its electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's structural features suggest potential applications in drug design, particularly in targeting specific biological pathways or receptors. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to elucidate its pharmacological properties.
Formula:C26H25NO2
InChI:InChI=1/C26H25NO2/c28-26(29)16-7-17-27(18-22-12-5-10-20-8-1-3-14-24(20)22)19-23-13-6-11-21-9-2-4-15-25(21)23/h1-6,8-15H,7,16-19H2,(H,28,29)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.