CAS 129046-87-3
:Boc-Asp-OFm
Description:
Boc-Asp-OFm, also known as N-Boc-L-aspartic acid phenyl methyl ester, is a derivative of aspartic acid, an amino acid that plays a crucial role in various biological processes. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in peptide synthesis, which helps to prevent unwanted reactions during the synthesis process. The "OFm" (phenyl methyl ester) indicates that the carboxylic acid group of aspartic acid is esterified, enhancing its solubility and stability. This compound is typically utilized in organic synthesis and peptide chemistry, particularly in the preparation of peptides where the protection of functional groups is necessary. Its structure allows for selective reactions, making it valuable in the development of pharmaceuticals and biochemicals. The compound is generally characterized by its solid state at room temperature, and it is soluble in organic solvents. Safety data should be consulted for handling, as with all chemical substances, to ensure proper laboratory practices.
Formula:C23H25NO6
InChI:InChI=1/C23H25NO6/c1-23(2,3)30-22(28)24-19(12-20(25)26)21(27)29-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,28)(H,25,26)/t19-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CC(=O)O)C(=O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- N-alpha-tert-Butyloxycarbonylaspartic acid beta-fluorenylmethyl ester
- 1-(9H-Fluoren-9-ylmethyl) N-((1,1-dimethylethoxy)carbonyl)-L-aspartate
- BA-beta-Fme
- Nalpha-Boc-asp-beta-fluorenylmethyl ester
- L-Aspartic acid, N-((1,1-dimethylethoxy)carbonyl)-, 1-(9H-fluoren-9-ylmethyl) ester
- (3S)-3-[(tert-butoxycarbonyl)amino]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(3S)-4-(9H-Fluoren-9-ylmethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid
CAS:(3S)-4-(9H-Fluoren-9-ylmethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acidPurity:≥95%Color and Shape:SolidMolecular weight:411.45g/molBoc-L-aspartic acid a-9-fluorenylmethyl ester
CAS:<p>Boc-L-aspartic acid a-9-fluorenylmethyl ester is a synthetic compound that mimics the structure of acetylcholine. It has been shown to be an efficient method for generating pseudopeptides and cyclic peptides. This compound may be used as a surrogate for acetylcholine in virus research, since it can bind to the same receptor. Boc-L-aspartic acid a-9-fluorenylmethyl ester has also been used to generate monoclonal antibodies that are neutralizing against foot-and-mouth disease viruses.</p>Formula:C23H25NO6Purity:Min. 97 Area-%Molecular weight:411.45 g/mol


