CAS 129050-62-0
:β-Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3)
Description:
β-Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3), commonly referred to as sodium bis(β-alaninate), is an amino acid derivative characterized by its dual carboxymethyl groups attached to the β-alanine backbone. This compound is typically a white to off-white powder, soluble in water, which enhances its utility in various biochemical applications. The presence of multiple carboxyl groups imparts significant acidity, allowing it to act as a buffering agent in biological systems. Its sodium salt form facilitates better solubility and stability in aqueous environments. This compound is often utilized in the synthesis of pharmaceuticals, as well as in research settings for its role in metabolic pathways and as a potential chelating agent. Additionally, it may exhibit properties that support cellular functions and metabolic processes, making it of interest in nutritional and therapeutic contexts. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H12NNaO6
InChI:InChI=1/C7H11NO6.3Na/c9-5(10)1-2-8(3-6(11)12)4-7(13)14;;;/h1-4H2,(H,9,10)(H,11,12)(H,13,14);;;/q;3*+1/p-3
InChI key:InChIKey=ZNIXXIUORRRIKT-UHFFFAOYSA-N
SMILES:N(CCC(O)=O)(CC(O)=O)CC(O)=O.[Na]
Synonyms:- N,N-Bis(carboxymethyl)-β-alanine trisodium salt
- N-(2-Carboxyethyl)iminodiacetic acid trisodium salt
- beta-Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3)
- beta-Alanine, N,N-bis(carboxymethyl)-, trisodium salt
- β-Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3)
- β-Alanine, N,N-bis(carboxymethyl)-, trisodium salt
- B-Alanine-N,N-diacetic acid trisodium salt
- trisodium N,N-bis(carboxymethyl)-β-alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.