CAS 129053-68-5
:2-Chloro-5-methyloxazole
Description:
2-Chloro-5-methyloxazole is a heterocyclic organic compound characterized by the presence of both chlorine and a methyl group attached to an oxazole ring. The oxazole ring consists of a five-membered aromatic structure containing two nitrogen atoms and three carbon atoms, with the chlorine substituent located at the second position and the methyl group at the fifth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features, which can influence biological activity. The presence of the chlorine atom can enhance the compound's reactivity and solubility in various solvents. Additionally, 2-Chloro-5-methyloxazole may exhibit specific properties such as moderate stability under standard conditions, but it should be handled with care due to potential toxicity and environmental impact. As with many chemical substances, proper safety protocols should be followed when working with this compound.
Formula:C4H4ClNO
InChI:InChI=1S/C4H4ClNO/c1-3-2-6-4(5)7-3/h2H,1H3
InChI key:InChIKey=CBCCZOGCQCTMGJ-UHFFFAOYSA-N
SMILES:CC=1OC(Cl)=NC1
Synonyms:- 2-Chloro-5-methyl-1,3-oxazole
- 2-Chloro-5-methyloxazole
- Oxazole, 2-chloro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.