CAS 129053-70-9

2-bromo-5-phenyl-1,3-oxazole

Description:

2-Bromo-5-phenyl-1,3-oxazole is a heterocyclic organic compound characterized by the presence of both bromine and a phenyl group attached to an oxazole ring. The oxazole ring consists of a five-membered aromatic structure containing two nitrogen atoms and three carbon atoms, contributing to its unique chemical properties. The bromine substituent at the 2-position enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The phenyl group at the 5-position provides additional stability and can influence the compound's electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the electrophilic nature of the bromine atom, allowing for further functionalization. Additionally, 2-bromo-5-phenyl-1,3-oxazole may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₉H₆BrNO

InChI: InChI=1/C9H6BrNO/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-6H

SMILES: c1ccc(cc1)c1cnc(Br)o1

Synonyms:

• Oxazole, 2-Bromo-5-Phenyl-
• 2-Bromo-5-Phenyl-Oxazole
• 2-Bromo-5-phenyl-1,3-oxazole

2-BROMO-5-PHENYLOXAZOLE

CAS: 129053-70-9

Formula: C₉H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.0540

Ref: IN-DA0072YY

2-Bromo-5-phenyl-1,3-oxazole

CAS: 129053-70-9

2-Bromo-5-phenyl-1,3-oxazole

Formula: C₉H₆BrNO

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 224.05g/mol

Ref: 54-OR963800

2-Bromo-5-phenyl-1,3-oxazole

CAS: 129053-70-9

Formula: C₉H₆BrNO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 224.057

Ref: 10-F077714