CAS 129055-63-6

1-Oxaspiro[4.5]decane-2-methanol

Description:

1-Oxaspiro[4.5]decane-2-methanol is a chemical compound characterized by its unique spirocyclic structure, which features a fused ring system that includes an ether functional group. The presence of the methanol group indicates that it has a hydroxyl (-OH) functional group attached to a carbon atom within the spiro framework. This compound is likely to exhibit properties typical of spiro compounds, such as rigidity due to its cyclic structure, which can influence its reactivity and interaction with other molecules. The ether linkage contributes to its polarity, potentially affecting its solubility in various solvents. Additionally, the compound may have applications in organic synthesis or as a building block in the development of pharmaceuticals or agrochemicals, given the importance of spiro compounds in medicinal chemistry. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would require experimental determination or detailed computational studies for precise characterization.

Formula: C₁₀H₁₈O₂

InChI: InChI=1S/C10H18O2/c11-8-9-4-7-10(12-9)5-2-1-3-6-10/h9,11H,1-8H2

InChI key: InChIKey=NXROIUACPSTQQX-UHFFFAOYSA-N

SMILES: C(O)C1OC2(CC1)CCCCC2

Synonyms:

• 1-Oxaspiro[4.5]decane-2-methanol
• [1-Oxaspiro[4.5]decan-2-yl]methanol
• (2RS)-(1-oxaspiro[4.5]dec-2-yl)methanol

{1-Oxaspiro[4.5]decan-2-yl}methanol

CAS: 129055-63-6

Versatile small molecule scaffold

Formula: C₁₀H₁₈O₂

Purity: Min. 95%

Molecular weight: 170.25 g/mol

Ref: 3D-EFA05563