CAS 1290625-93-2
:1-(1,1-Dimethylethyl) 4-(1H-imidazol-1-yl)-1,4-piperidinedicarboxylate
Description:
1-(1,1-Dimethylethyl) 4-(1H-imidazol-1-yl)-1,4-piperidinedicarboxylate, with the CAS number 1290625-93-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with both a dimethyl group and an imidazole moiety. This compound typically exhibits properties associated with both piperidine and imidazole derivatives, such as potential biological activity and solubility in organic solvents. The presence of carboxylate groups suggests it may participate in various chemical reactions, including esterification and salt formation. Its molecular structure indicates that it could interact with biological systems, possibly serving as a pharmacophore in drug development. The compound's stability, reactivity, and solubility can be influenced by the steric and electronic effects of the substituents, making it of interest in medicinal chemistry and related fields. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C14H21N3O4
InChI:InChI=1S/C14H21N3O4/c1-13(2,3)21-12(20)16-7-4-14(5-8-16,11(18)19)17-9-6-15-10-17/h6,9-10H,4-5,7-8H2,1-3H3,(H,18,19)
InChI key:InChIKey=ODEDUUBIWMPGEB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCN(C(OC(C)(C)C)=O)CC1)N2C=CN=C2
Synonyms:- 1-(1,1-Dimethylethyl) 4-(1H-imidazol-1-yl)-1,4-piperidinedicarboxylate
- 1,4-Piperidinedicarboxylic acid, 4-(1H-imidazol-1-yl)-, 1-(1,1-dimethylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.