CymitQuimica logo

CAS 129075-74-7

:

5-Ethoxy-3,4-dihydro-1(2H)-isoquinolinone

Description:
5-Ethoxy-3,4-dihydro-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinoline structure, which features a bicyclic system containing a nitrogen atom. This compound typically exhibits a molecular formula that reflects its ethoxy and dihydroisoquinolinone functionalities. It is known for its potential biological activity, which may include effects on the central nervous system or other pharmacological properties, making it of interest in medicinal chemistry. The presence of the ethoxy group contributes to its solubility and reactivity, influencing its interactions in biological systems. Additionally, the dihydroisoquinolinone framework can participate in various chemical reactions, such as oxidation or substitution, which may be relevant for synthetic applications. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other reagents. Overall, 5-Ethoxy-3,4-dihydro-1(2H)-isoquinolinone represents a versatile structure with implications in both research and potential therapeutic contexts.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-2-14-10-5-3-4-9-8(10)6-7-12-11(9)13/h3-5H,2,6-7H2,1H3,(H,12,13)
InChI key:InChIKey=AZBGAKGBBACRFE-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(C(=O)NCC2)=CC=C1
Synonyms:
  • 5-Ethoxy-3,4-dihydro-1(2H)-isoquinolinone
  • 1(2H)-Isoquinolinone, 5-ethoxy-3,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.