CAS 1291-72-1
:(3-Carboxypropionyl)Ferrocene
Description:
(3-Carboxypropionyl)Ferrocene, with the CAS number 1291-72-1, is an organometallic compound that features a ferrocene structure, which consists of two cyclopentadienyl rings sandwiching a central iron atom. This compound is characterized by the presence of a carboxypropionyl functional group, which introduces both carboxylic acid and propionyl functionalities into the ferrocene framework. The presence of these functional groups enhances its solubility in polar solvents and may impart interesting chemical reactivity, making it suitable for various applications in organic synthesis and materials science. The compound exhibits typical ferrocene properties, such as stability and a distinct red-orange color, and can participate in redox reactions due to the iron center. Additionally, the carboxylic acid group can engage in hydrogen bonding and may influence the compound's interactions with other molecules, potentially affecting its biological activity and utility in coordination chemistry. Overall, (3-Carboxypropionyl)Ferrocene represents a versatile compound with potential applications in catalysis, drug delivery, and as a building block in organic synthesis.
Formula:C14H14FeO3
InChI:InChI=1/C9H9O3.C5H5.Fe/c10-8(5-6-9(11)12)7-3-1-2-4-7;1-2-4-5-3-1;/h1-4H,5-6H2,(H,11,12);1-5H;/rC14H14FeO3/c16-13(8-9-14(17)18)11-6-3-7-12(11)15-10-4-1-2-5-10/h1-7,10,12H,8-9H2,(H,17,18)
SMILES:C1=CC(C=C1)[Fe]C1C=CC=C1C(=O)CCC(=O)O
Synonyms:- 3-Ferrocenoylptopionic acid
- 3-Ferrocenoylpropionic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Ferrocenoylpropionic Acid
CAS:Formula:C14H14FeO3Purity:>95.0%(GC)(T)Color and Shape:Orange to Brown to Dark red powder to crystalMolecular weight:286.11(3-Carboxy-1-Oxopropyl)Ferrocene
CAS:Formula:C14H5FeO3Purity:97%Color and Shape:SolidMolecular weight:277.0327(3-Carboxy-1-oxopropyl)ferrocene
CAS:(3-Carboxy-1-oxopropyl)ferroceneFormula:C14H14FeO3Purity:97%Molecular weight:286.13-Ferrocenoylpropionic Acid
CAS:Controlled ProductApplications 3-FERROCENOYLPROPIONIC ACID (cas# 1291-72-1) is a useful research chemical.
Formula:C14H14FeO3Color and Shape:NeatMolecular weight:286.1




