CAS 1291177-22-4

4-Bromo-5-ethyl-1H-pyrazole-3-carboxylic acid

Description:

4-Bromo-5-ethyl-1H-pyrazole-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and an ethyl group at the 5-position contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, which is often explored in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its application in synthesis and formulation. Additionally, the compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be considered due to the presence of bromine, which can be hazardous.

Formula: C₆H₇BrN₂O₂

InChI: InChI=1S/C6H7BrN2O2/c1-2-3-4(7)5(6(10)11)9-8-3/h2H2,1H3,(H,8,9)(H,10,11)

InChI key: InChIKey=PIUROJWXCZWEPW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=C(CC)NN1

Synonyms:

• 4-Bromo-5-ethyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 4-bromo-5-ethyl-

4-Bromo-3-ethyl-1H-pyrazole-5-carboxylic acid

CAS: 1291177-22-4

Versatile small molecule scaffold

Formula: C₆H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 219.04 g/mol

Ref: 3D-RBC17722