CAS 129119-42-2

4′-Ethyl-N,N-bis(4-methylphenyl)[1,1′-biphenyl]-4-amine

Description:

4′-Ethyl-N,N-bis(4-methylphenyl)[1,1′-biphenyl]-4-amine, with CAS number 129119-42-2, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an ethyl group and two para-substituted methylphenyl groups attached to a central amine, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple aromatic rings suggests potential applications in organic electronics, such as in the development of organic light-emitting diodes (OLEDs) or as a dye. The amine functional group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure may influence its electronic properties, making it of interest in materials science and organic synthesis. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₂₈H₂₇N

InChI: InChI=1S/C28H27N/c1-4-23-9-11-24(12-10-23)25-13-19-28(20-14-25)29(26-15-5-21(2)6-16-26)27-17-7-22(3)8-18-27/h5-20H,4H2,1-3H3

InChI key: InChIKey=MKIVRGOMSLSEOM-UHFFFAOYSA-N

SMILES: N(C1=CC=C(C=C1)C2=CC=C(CC)C=C2)(C3=CC=C(C)C=C3)C4=CC=C(C)C=C4

Synonyms:

• 4′-Ethyl-N,N-bis(4-methylphenyl)[1,1′-biphenyl]-4-amine
• [1,1′-Biphenyl]-4-amine, 4′-ethyl-N,N-bis(4-methylphenyl)-

[1,1'-Biphenyl]-4-amine, 4'-ethyl-N,N-bis(4-methylphenyl)-

CAS: 129119-42-2

Formula: C₂₈H₂₇N

Molecular weight: 377.5207

Ref: IN-DA000YVA