CymitQuimica logo

CAS 129119-77-3

:

7-[3-(Chlorodimethylsilyl)Propoxy-4-Methylcoumarin

Description:
7-[3-(Chlorodimethylsilyl)Propoxy-4-Methylcoumarin, identified by its CAS number 129119-77-3, is a chemical compound that belongs to the class of coumarins, which are known for their aromatic properties and potential biological activities. This particular compound features a chlorodimethylsilyl group, which enhances its reactivity and solubility in organic solvents. The presence of the propoxy group contributes to its structural complexity and may influence its interaction with biological systems. Coumarins are often studied for their potential applications in pharmaceuticals, including anti-inflammatory, anticoagulant, and antimicrobial properties. The chlorodimethylsilyl moiety can also impart unique characteristics, such as increased stability and the ability to participate in further chemical reactions, making it a valuable compound in synthetic organic chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties, which is crucial for its potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H19ClO3Si
InChI:InChI=1/C15H19ClO3Si/c1-11-9-15(17)19-14-10-12(5-6-13(11)14)18-7-4-8-20(2,3)16/h5-6,9-10H,4,7-8H2,1-3H3
SMILES:Cc1cc(=O)oc2cc(ccc12)OCCC[Si](C)(C)Cl
Synonyms:
  • 10% In Acetonitrile
  • 7-[3-(Chlorodimethylsilyl)Propoxy-4-Methylcoumarin: 10% In Acetonitrile
  • 7-{3-[chloro(dimethyl)silyl]propoxy}-4-methyl-2H-chromen-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.