CymitQuimica logo

CAS 1291275-81-4

:

Methyl 5-cyclopropyl-4-iodo-1H-pyrazole-3-carboxylate

Description:
Methyl 5-cyclopropyl-4-iodo-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a cyclopropyl group and an iodine atom at specific positions on the pyrazole ring contributes to its unique reactivity and potential biological activity. The carboxylate functional group, indicated by the ester moiety (methyl ester), suggests that this compound may participate in various chemical reactions, including esterification and nucleophilic substitutions. The iodine substituent can enhance the compound's reactivity, making it a potential candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the structural features of this compound may influence its solubility, stability, and interaction with biological targets, making it of interest in drug discovery and development. Overall, Methyl 5-cyclopropyl-4-iodo-1H-pyrazole-3-carboxylate exemplifies a complex organic molecule with potential utility in various chemical and pharmaceutical contexts.
Formula:C8H9IN2O2
InChI:InChI=1S/C8H9IN2O2/c1-13-8(12)7-5(9)6(10-11-7)4-2-3-4/h4H,2-3H2,1H3,(H,10,11)
InChI key:InChIKey=OFGGYNMCCTWFFC-UHFFFAOYSA-N
SMILES:IC1=C(NN=C1C(OC)=O)C2CC2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-cyclopropyl-4-iodo-, methyl ester
  • Methyl 5-cyclopropyl-4-iodo-1H-pyrazole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.