CAS 129138-59-6

Ethanone, 1-(4-amino-3,5-dichlorophenyl)-2-[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]-

Description:

Ethanone, 1-(4-amino-3,5-dichlorophenyl)-2-[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]- is a chemical compound characterized by its complex structure, which includes an ethanone moiety and a substituted aromatic ring. The presence of the 4-amino group and dichlorine substituents on the phenyl ring suggests potential biological activity, as such modifications can influence the compound's interaction with biological targets. The incorporation of deuterated methyl groups indicates that this compound may be used in studies requiring isotopic labeling, such as pharmacokinetic or metabolic investigations. The compound's molecular structure likely contributes to its solubility and reactivity, which are essential for its application in medicinal chemistry or as a research tool. Additionally, the presence of multiple functional groups may affect its stability and reactivity under various conditions. Overall, this compound exemplifies the intricate design often found in pharmaceutical agents, where specific modifications are made to enhance efficacy and reduce side effects.

Formula: C₁₂H₇Cl₂D₉N₂O

InChI: InChI=1S/C12H16Cl2N2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,16H,6,15H2,1-3H3/i1D3,2D3,3D3

InChI key: InChIKey=QWIQLKPBFDBNMD-GQALSZNTSA-N

SMILES: C(CNC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])(=O)C1=CC(Cl)=C(N)C(Cl)=C1

Synonyms:

• Ethanone, 1-(4-amino-3,5-dichlorophenyl)-2-[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]-

Ethanone, 1-(4-amino-3,5-dichlorophenyl)-2-[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]- (9CI)

CAS: 129138-59-6

Formula: C₁₂H₇Cl₂D₉N₂O

Molecular weight: 284.2297

Ref: IN-DA000YW5