CAS 129145-51-3
:Gancaonin M
Description:
Gancaonin M is a naturally occurring flavonoid compound, primarily derived from certain plant species, particularly those in the genus *Gancao*, commonly known as licorice. This compound is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Gancaonin M exhibits various biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. Its solubility properties typically allow it to dissolve in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. The compound's mechanism of action often involves modulation of cellular signaling pathways, which can lead to protective effects against oxidative stress. Additionally, Gancaonin M may interact with various biological targets, enhancing its therapeutic potential. As research continues, the full scope of its applications in medicine and health is being explored, highlighting the importance of natural products in drug discovery and development.
Formula:C21H20O5
InChI:InChI=1S/C21H20O5/c1-12(2)4-9-15-17(22)10-18(23)19-20(24)16(11-26-21(15)19)13-5-7-14(25-3)8-6-13/h4-8,10-11,22-23H,9H2,1-3H3
InChI key:InChIKey=DDLPIQXHEKZHQX-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=C2C(C(=O)C(=CO2)C3=CC=C(OC)C=C3)=C(O)C=C1O
Synonyms:- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-methoxyphenyl)-8-(3-methyl-2-butenyl)-
- 4H-1-benzopyran-4-one, 5,7-dihydroxy-3-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-
- 5,7-Dihydroxy-3-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- Gancaonin M
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Gancaonin M
CAS:Gancaonin M is a natural product from Glycyrrhiza uralensis Fisch.Formula:C21H20O5Purity:98%Color and Shape:SolidMolecular weight:352.38Gancaonin M
CAS:Gancaonin M is a natural compound that functions as an anti-inflammatory agent, which is derived from the roots of the licorice plant, Glycyrrhiza uralensis. This flavonoid-like chemical substance exhibits its effects primarily through the inhibition of pro-inflammatory mediators, alongside its strong antioxidant activities. The mode of action involves the attenuation of various signaling pathways associated with the inflammatory response, potentially reducing oxidative stress and cellular damage.
Formula:C21H20O5Purity:Min. 95%Molecular weight:352.4 g/molRef: 3D-EFA14551
Discontinued product


