
CAS 1291486-04-8
:3-Ethyltricyclo[3.3.1.13,7]decane-1-ethanol
Description:
3-Ethyltricyclo[3.3.1.1^3,7]decane-1-ethanol is a complex organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of an ethyl group and a hydroxyl (-OH) functional group at the first position contributes to its chemical properties, including potential solubility in organic solvents and reactivity in various chemical reactions. This compound may exhibit interesting stereochemistry due to the rigid framework of the tricyclic system, which can influence its physical properties such as boiling point, melting point, and density. Additionally, the hydroxyl group suggests that it may participate in hydrogen bonding, affecting its interactions with other molecules. The compound's structural complexity may also lead to unique biological activities, making it a subject of interest in medicinal chemistry and materials science. However, specific data regarding its reactivity, stability, and applications would require further investigation through experimental studies and literature review.
Formula:C14H24O
InChI:InChI=1S/C14H24O/c1-2-13-6-11-5-12(7-13)9-14(8-11,10-13)3-4-15/h11-12,15H,2-10H2,1H3
InChI key:InChIKey=ABXXDSJSUSJJJW-UHFFFAOYSA-N
SMILES:C(CO)C12CC3(CC)CC(C1)CC(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decane-1-ethanol, 3-ethyl-
- 2-(3-Ethyladamantan-1-yl)ethan-1-ol
- 3-Ethyltricyclo[3.3.1.13,7]decane-1-ethanol
- 2-(3-Ethyl-1-adamantyl)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.