
CAS 1291486-25-3
:Ethyl 1,2,3,4-tetrahydro-2-thioxo-4-quinolinecarboxylate
Description:
Ethyl 1,2,3,4-tetrahydro-2-thioxo-4-quinolinecarboxylate is a chemical compound characterized by its unique quinoline structure, which includes a tetrahydro configuration and a thioxo group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the quinoline moiety. It is likely to be a solid at room temperature, with solubility in organic solvents, reflecting its non-polar characteristics. The thioxo group may contribute to its reactivity, potentially allowing for interactions with various biological targets. Ethyl esters, such as this compound, often display moderate to high lipophilicity, which can influence their pharmacokinetic properties. Additionally, the presence of the carboxylate functional group may impart acidic characteristics, affecting its behavior in different pH environments. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, specific data on its biological activity and safety profile would require further investigation.
Formula:C12H13NO2S
InChI:InChI=1S/C12H13NO2S/c1-2-15-12(14)9-7-11(16)13-10-6-4-3-5-8(9)10/h3-6,9H,2,7H2,1H3,(H,13,16)
InChI key:InChIKey=MBUHKOCHFHPXJK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C=2C(NC(=S)C1)=CC=CC2
Synonyms:- 4-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-thioxo-, ethyl ester
- Ethyl 1,2,3,4-tetrahydro-2-thioxo-4-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.