CAS 1291486-38-8

1-[(Dimethylamino)(2-fluorophenyl)methyl]-2-naphthalenol

Description:

1-[(Dimethylamino)(2-fluorophenyl)methyl]-2-naphthalenol, identified by its CAS number 1291486-38-8, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a dimethylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the fluorophenyl group may influence its electronic properties, potentially enhancing its lipophilicity and biological activity. As a phenolic compound, it may also exhibit antioxidant properties. The dimethylamino group can impart basicity, affecting its interaction with acids and bases. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of pharmaceuticals. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or detailed literature reviews. Overall, this compound represents a unique structure that may have significant implications in various chemical and biological contexts.

Formula: C₁₉H₁₈FNO

InChI: InChI=1S/C19H18FNO/c1-21(2)19(15-9-5-6-10-16(15)20)18-14-8-4-3-7-13(14)11-12-17(18)22/h3-12,19,22H,1-2H3

InChI key: InChIKey=JNTFIELVHJRPAH-UHFFFAOYSA-N

SMILES: C(N(C)C)(C=1C2=C(C=CC1O)C=CC=C2)C3=C(F)C=CC=C3

Synonyms:

• 1-[(Dimethylamino)(2-fluorophenyl)methyl]-2-naphthalenol
• 2-Naphthalenol, 1-[(dimethylamino)(2-fluorophenyl)methyl]-