CAS 1291486-63-9

3-[[(4-Ethylphenyl)sulfonyl]methylamino]-2-thiophenecarboxylic acid

Description:

3-[[(4-Ethylphenyl)sulfonyl]methylamino]-2-thiophenecarboxylic acid, with the CAS number 1291486-63-9, is a chemical compound characterized by its complex structure, which includes a thiophene ring, a carboxylic acid functional group, and a sulfonamide moiety. This compound features a sulfonyl group attached to a phenyl ring that is further substituted with an ethyl group, contributing to its hydrophobic characteristics. The presence of the thiophene ring imparts unique electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The carboxylic acid group enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Overall, this compound's structural features suggest potential for diverse biological activity, although specific applications and efficacy would depend on further research and testing.

Formula: C₁₄H₁₅NO₄S₂

InChI: InChI=1S/C14H15NO4S2/c1-3-10-4-6-11(7-5-10)21(18,19)15(2)12-8-9-20-13(12)14(16)17/h4-9H,3H2,1-2H3,(H,16,17)

InChI key: InChIKey=AFFNQZGVHQZCNC-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=C(CC)C=C1)(C)C2=C(C(O)=O)SC=C2

Synonyms:

• 3-[[(4-Ethylphenyl)sulfonyl]methylamino]-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 3-[[(4-ethylphenyl)sulfonyl]methylamino]-